cas: 6558-85-6 — see every product listed under this CAS number, including other names
1,3,6,8-Tetramethyl-9H-carbazole, 98% (CAS 6558-85-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A552586-250mg |
| cas | 6558-85-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Ambeed | 5g | 3774.62 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 3696.50 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Fluorochem | 5g | 2882.34 Pln | |
| Fluorochem | 100mg | 180.16 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 648.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,3,6,8-tetramethyl-9H-carbazole (CAS 6558-85-6) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: 1,3,6,8-tetramethyl-9H-carbazole. InChIKey: KBGPFZUZKTUOII-UHFFFAOYSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 1,3,6,8-tetramethyl-9H-carbazole |
| InChIKey | KBGPFZUZKTUOII-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C3=CC(=CC(=C3N2)C)C)C |
Computed by PubChem (NCBI)