CAS 155155-73-0 appears in our catalog under these names: (2R,5R)-2,5-Diphenylpyrrolidine, 95%, (2R,5R)–2,5–Diphenylpyrrolidine, (2R,5R)-2,5-Diphenylpyrrolidine, (2R,5R)-2,5-Diphenylpyrrolidine, >95.0%(GC), (2R,5R)-2,5-Diphenylpyrrolidine 95%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 25mg, 250mg, 10mg, 50mg, 1g.
(2R,5R)-2,5-diphenylpyrrolidine (CAS 155155-73-0) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: (2R,5R)-2,5-diphenylpyrrolidine. InChIKey: NAOGHMNKMJMMNQ-HZPDHXFCSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | (2R,5R)-2,5-diphenylpyrrolidine |
| InChIKey | NAOGHMNKMJMMNQ-HZPDHXFCSA-N |
| SMILES | C1C[C@@H](N[C@H]1C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)