CAS 22147-84-8 is the registry number for rel-(2R,5R)-2,5-Diphenylpyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-2,5-diphenylpyrrolidine (CAS 22147-84-8) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: (2R,5R)-2,5-diphenylpyrrolidine. InChIKey: NAOGHMNKMJMMNQ-HZPDHXFCSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | (2R,5R)-2,5-diphenylpyrrolidine |
| InChIKey | NAOGHMNKMJMMNQ-HZPDHXFCSA-N |
| SMILES | C1C[C@@H](N[C@H]1C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)