CAS 107128-00-7 appears in our catalog under these names: 1-Benzhydrylazetidine, 97%, 1–(Diphenylmethyl)azetidine, 1-BENZHYDRYLAZETIDINE, 96%, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 10g.
1-benzhydrylazetidine (CAS 107128-00-7) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: 1-benzhydrylazetidine. InChIKey: AZHWVHNIAGJINK-UHFFFAOYSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 1-benzhydrylazetidine |
| InChIKey | AZHWVHNIAGJINK-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)