CAS 5424-66-8 is the registry number for 2-((1,1'-Biphenyl)-4-yl)pyrrolidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-phenylphenyl)pyrrolidine (CAS 5424-66-8) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: 2-(4-phenylphenyl)pyrrolidine. InChIKey: VFTXXPDSXZVEAD-UHFFFAOYSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 2-(4-phenylphenyl)pyrrolidine |
| InChIKey | VFTXXPDSXZVEAD-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)