CAS 1176740-73-0 appears in our catalog under these names: 5-(2,6-Dimethylphenyl)indoline, 95%, 5–(2，6–Dimethylphenyl)indoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g.
5-(2,6-dimethylphenyl)-2,3-dihydro-1H-indole (CAS 1176740-73-0) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: 5-(2,6-dimethylphenyl)-2,3-dihydro-1H-indole. InChIKey: BJTXJWHVSAAQJQ-UHFFFAOYSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 5-(2,6-dimethylphenyl)-2,3-dihydro-1H-indole |
| InChIKey | BJTXJWHVSAAQJQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CC3=C(C=C2)NCC3 |
Computed by PubChem (NCBI)