cas: 3147-58-8 — see every product listed under this CAS number, including other names
1,3–Dihydroxy–2–naphthoic acid (CAS 3147-58-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD10959-1g |
| cas | 3147-58-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 1369.32 Pln | |
| GLPBio | 250mg | 714.05 Pln | |
| GLPBio | 50mg | 559.60 Pln | |
| GLPBio | 5g | 3400.66 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-dihydroxynaphthalene-2-carboxylic acid (CAS 3147-58-8) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 1,3-dihydroxynaphthalene-2-carboxylic acid. InChIKey: USZZLTVYRPLBMB-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1,3-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | USZZLTVYRPLBMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2O)C(=O)O)O |
Computed by PubChem (NCBI)