cas: 3147-58-8 — see every product listed under this CAS number, including other names
1,3-Dihydroxy-2-naphthoic acid, 98% (CAS 3147-58-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210554-100MG |
| cas | 3147-58-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 3012.50 Pln | |
| Fluorochem | 10g | 5975.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,3-dihydroxynaphthalene-2-carboxylic acid (CAS 3147-58-8) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 1,3-dihydroxynaphthalene-2-carboxylic acid. InChIKey: USZZLTVYRPLBMB-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1,3-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | USZZLTVYRPLBMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2O)C(=O)O)O |
Computed by PubChem (NCBI)