cas: 4550-72-5 — see every product listed under this CAS number, including other names
1,3-Bis(4-aminophenyl)urea, 95%, 95% (CAS 4550-72-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DH77-5mg |
| cas | 4550-72-5 |
| size | 5mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 25mg | 549.20 Pln | |
| Chemat | 50mg | 861.20 Pln | |
| Chemat | 100mg | 1259.60 Pln | |
| Chemat | 250mg | 2176.40 Pln | |
| Chemat | 10mg | 333.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-bis(4-aminophenyl)urea (CAS 4550-72-5) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: 1,3-bis(4-aminophenyl)urea. InChIKey: MAPWYRGGJSHAAU-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | 1,3-bis(4-aminophenyl)urea |
| InChIKey | MAPWYRGGJSHAAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC(=O)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)