CAS 51883-88-6 is the registry number for N-[(3,5-Dimethyl-1h-pyrazol-1-yl)(imino)methyl]benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(3,5-dimethylpyrazole-1-carboximidoyl)benzamide (CAS 51883-88-6) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: N-(3,5-dimethylpyrazole-1-carboximidoyl)benzamide. InChIKey: KDTSAMCTLHBETH-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | N-(3,5-dimethylpyrazole-1-carboximidoyl)benzamide |
| InChIKey | KDTSAMCTLHBETH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=N)NC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)