CAS 63272-29-7 is the registry number for 1,3-Bis(5-methylpyridin-2-yl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3-bis(5-methyl-2-pyridinyl)urea (CAS 63272-29-7) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: 1,3-bis(5-methyl-2-pyridinyl)urea. InChIKey: UVINHCNJBKPUSO-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | 1,3-bis(5-methyl-2-pyridinyl)urea |
| InChIKey | UVINHCNJBKPUSO-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)NC(=O)NC2=NC=C(C=C2)C |
Computed by PubChem (NCBI)