CAS 103026-12-6 appears in our catalog under these names: 7-(2-Furylmethyl)-5,6-dimethyl-7h-pyrrolo[2,3-d]pyrimidin-4-amine, 95%, 7-(Furan-2-ylmethyl)-5,6-dimethyl-7H-pyrrolo(2,3-d)pyrimidin-4-amine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
7-(furan-2-ylmethyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 103026-12-6) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: 7-(furan-2-ylmethyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: JOCMWXDUQHVTDD-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | 7-(furan-2-ylmethyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | JOCMWXDUQHVTDD-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=NC=NC(=C12)N)CC3=CC=CO3)C |
Computed by PubChem (NCBI)