CAS 241146-78-1 is the registry number for (2Z)-3-(Dimethylamino)-1-phenyl-2-(1h-1,2,4-triazol-1-yl)prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-3-(dimethylamino)-1-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one (CAS 241146-78-1) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: (Z)-3-(dimethylamino)-1-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one. InChIKey: GBVHLGAGVQFALP-WQLSENKSSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | (Z)-3-(dimethylamino)-1-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
| InChIKey | GBVHLGAGVQFALP-WQLSENKSSA-N |
| SMILES | CN(C)/C=C(/C(=O)C1=CC=CC=C1)\N2C=NC=N2 |
Computed by PubChem (NCBI)