CAS 4550-72-5 appears in our catalog under these names: 1,3-Bis(4-aminophenyl)urea, 95%, NSC 15364, NSC 15364/ 97.22% (existing batch purity), 1,3-Bis(4-aminophenyl)urea, 95%, 95%, NSC 15364, 99.88%. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 100mg, 50mg, 5mg, 25mg, 250 mg.
1,3-bis(4-aminophenyl)urea (CAS 4550-72-5) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: 1,3-bis(4-aminophenyl)urea. InChIKey: MAPWYRGGJSHAAU-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | 1,3-bis(4-aminophenyl)urea |
| InChIKey | MAPWYRGGJSHAAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC(=O)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)