cas: 126716-90-3 — see every product listed under this CAS number, including other names
1,3-Bis(4-hydroxyphenoxy)benzene 95% (CAS 126716-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A940365-100mg |
| cas | 126716-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 932.19 Pln | |
| Ambeed | 10g | 1666.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A940365 |
4-[3-(4-hydroxyphenoxy)phenoxy]phenol (CAS 126716-90-3) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 4-[3-(4-hydroxyphenoxy)phenoxy]phenol. InChIKey: CJLPIPXJJJUBIV-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 4-[3-(4-hydroxyphenoxy)phenoxy]phenol |
| InChIKey | CJLPIPXJJJUBIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)O)OC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)