cas: 126716-90-3 — see every product listed under this CAS number, including other names
1,3-Bis(4-hydroxyphenoxy)benzene, >98.0%(GC) (CAS 126716-90-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1484-1G |
| cas | 126716-90-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 605.15 Pln | |
| TCI | 5g | 1947.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
4-[3-(4-hydroxyphenoxy)phenoxy]phenol (CAS 126716-90-3) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 4-[3-(4-hydroxyphenoxy)phenoxy]phenol. InChIKey: CJLPIPXJJJUBIV-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 4-[3-(4-hydroxyphenoxy)phenoxy]phenol |
| InChIKey | CJLPIPXJJJUBIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)O)OC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)