cas: 126716-90-3 — see every product listed under this CAS number, including other names
1,3-Bis(4-hydroxyphenoxy)benzene, 95%, 95% (CAS 126716-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111T65-100mg |
| cas | 126716-90-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1432.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[3-(4-hydroxyphenoxy)phenoxy]phenol (CAS 126716-90-3) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 4-[3-(4-hydroxyphenoxy)phenoxy]phenol. InChIKey: CJLPIPXJJJUBIV-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 4-[3-(4-hydroxyphenoxy)phenoxy]phenol |
| InChIKey | CJLPIPXJJJUBIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)O)OC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)