cas: 6972-79-8 — see every product listed under this CAS number, including other names
1,3-Bis(benzyloxy)-2-propanol 97% (CAS 6972-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184476-1g |
| cas | 6972-79-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 459.38 Pln | |
| Ambeed | 10g | 770.88 Pln | |
| Ambeed | 25g | 1532.94 Pln | |
| Ambeed | 100g | 4469.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A184476 |
1,3-bis(phenylmethoxy)propan-2-ol (CAS 6972-79-8) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 1,3-bis(phenylmethoxy)propan-2-ol. InChIKey: ARLSYSVVBAMYKA-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1,3-bis(phenylmethoxy)propan-2-ol |
| InChIKey | ARLSYSVVBAMYKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(COCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)