cas: 6972-79-8 — see every product listed under this CAS number, including other names
1,3-Bis(benzyloxy)-2-propanol, 96%, 96% (CAS 6972-79-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DHR-250mg |
| cas | 6972-79-8 |
| size | 250mg |
| availability | 100.438g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 381.20 Pln | |
| Chemat | 10g | 640.40 Pln | |
| Chemat | 25g | 1365.20 Pln | |
| Chemat | 100g | 4168.40 Pln | |
| Chemat | 50g | 2392.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1,3-bis(phenylmethoxy)propan-2-ol (CAS 6972-79-8) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 1,3-bis(phenylmethoxy)propan-2-ol. InChIKey: ARLSYSVVBAMYKA-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1,3-bis(phenylmethoxy)propan-2-ol |
| InChIKey | ARLSYSVVBAMYKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(COCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)