cas: 6972-79-8 — see every product listed under this CAS number, including other names
1,3-Bis(benzyloxy)-2-propanol (CAS 6972-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F542396-100MG |
| cas | 6972-79-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 716.43 Pln | |
| Fluorochem | 10g | 1226.67 Pln | |
| Fluorochem | 25g | 2450.20 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-bis(phenylmethoxy)propan-2-ol (CAS 6972-79-8) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 1,3-bis(phenylmethoxy)propan-2-ol. InChIKey: ARLSYSVVBAMYKA-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1,3-bis(phenylmethoxy)propan-2-ol |
| InChIKey | ARLSYSVVBAMYKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(COCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)