cas: 51145-74-5 — see every product listed under this CAS number, including other names
1,3-Diazaspiro(4.5)decane-2,4,8-trione, 98% (CAS 51145-74-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A222176-5g |
| cas | 51145-74-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17165.26 Pln | |
| AmBeed | 10g | 23141.44 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-diazaspiro[4.5]decane-2,4,8-trione (CAS 51145-74-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 1,3-diazaspiro[4.5]decane-2,4,8-trione. InChIKey: IVSBWJVHDCWNQR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 1,3-diazaspiro[4.5]decane-2,4,8-trione |
| InChIKey | IVSBWJVHDCWNQR-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1=O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)