CAS 136-79-8 appears in our catalog under these names: 2-Ethoxy-5-nitroaniline, 95%, 2-Ethoxy-5-nitroaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
2-ethoxy-5-nitroaniline (CAS 136-79-8) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 2-ethoxy-5-nitroaniline. InChIKey: AMMPGYPPRLWMLW-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 2-ethoxy-5-nitroaniline |
| InChIKey | AMMPGYPPRLWMLW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)