CAS 1138443-95-4 is the registry number for 5,6-Dimethoxypicolinaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(NE)-N-[(5,6-dimethoxy-2-pyridinyl)methylidene]hydroxylamine (CAS 1138443-95-4) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: (NE)-N-[(5,6-dimethoxy-2-pyridinyl)methylidene]hydroxylamine. InChIKey: FGIMNFLPYRRIJH-WEVVVXLNSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | (NE)-N-[(5,6-dimethoxy-2-pyridinyl)methylidene]hydroxylamine |
| InChIKey | FGIMNFLPYRRIJH-WEVVVXLNSA-N |
| SMILES | COC1=C(N=C(C=C1)/C=N/O)OC |
Computed by PubChem (NCBI)