CAS 171672-99-4 appears in our catalog under these names: 6-Oxo-1-propyl-1,6-dihydropyridazine-3-carboxylic acid, 95%, 6-Oxo-1-propyl-1,6-dihydropyridazine-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
6-oxo-1-propylpyridazine-3-carboxylic acid (CAS 171672-99-4) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 6-oxo-1-propylpyridazine-3-carboxylic acid. InChIKey: DJHVQCITSVMNLU-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 6-oxo-1-propylpyridazine-3-carboxylic acid |
| InChIKey | DJHVQCITSVMNLU-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C=CC(=N1)C(=O)O |
Computed by PubChem (NCBI)