CAS 51145-74-5 appears in our catalog under these names: 1,3–diazaspiro(4·5)decane–2,4,8–trione, 1,3-Diazaspiro[4.5]decane-2,4,8-trione, 95%, 1,3-Diazaspiro(4.5)decane-2,4,8-trione, 98%, 1,3-Diazaspiro(4.5)decane-2,4,8-trione. Offered by: GLPBio, Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 10g, 250mg.
1,3-diazaspiro[4.5]decane-2,4,8-trione (CAS 51145-74-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 1,3-diazaspiro[4.5]decane-2,4,8-trione. InChIKey: IVSBWJVHDCWNQR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 1,3-diazaspiro[4.5]decane-2,4,8-trione |
| InChIKey | IVSBWJVHDCWNQR-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1=O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)