CAS 1344086-34-5 appears in our catalog under these names: 5-Isopropoxypyrazine-2-carboxylic acid, 97%, 5-(Propan-2-yloxy)pyrazine-2-carboxylic acid, 95%, 5-(Propan-2-yloxy)pyrazine-2-carboxylic acid. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 50mg, 0,5g.
5-propan-2-yloxypyrazine-2-carboxylic acid (CAS 1344086-34-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 5-propan-2-yloxypyrazine-2-carboxylic acid. InChIKey: VJNSNJLSAALFQE-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 5-propan-2-yloxypyrazine-2-carboxylic acid |
| InChIKey | VJNSNJLSAALFQE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC=C(N=C1)C(=O)O |
Computed by PubChem (NCBI)