1,3-Diazaspiro[4.6]undecane-2,4-dione, 95%
cas: 707-16-4 — see every product listed under this CAS number, including other names
1,3-Diazaspiro[4.6]undecane-2,4-dione, 95% (CAS 707-16-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QM-6150-250mg |
| cas | 707-16-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 954.44 Pln | |
| Ambeed | 5g | 2289.44 Pln | |
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 813.20 Pln | |
| Chemat | 1g | 1941.20 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 864.16 Pln | |
| BLDpharm | 1g | 1025.22 Pln | |
| BLDpharm | 5g | 2458.05 Pln | |
| Fluorochem | 100mg | 929.90 Pln | |
| Fluorochem | 250mg | 1507.82 Pln | |
| Fluorochem | 1g | 3585.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1,3-diazaspiro[4.6]undecane-2,4-dione (CAS 707-16-4) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 1,3-diazaspiro[4.6]undecane-2,4-dione. InChIKey: DEXMKKYRTKSOCW-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1,3-diazaspiro[4.6]undecane-2,4-dione |
| InChIKey | DEXMKKYRTKSOCW-UHFFFAOYSA-N |
| SMILES | C1CCCC2(CC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)