CAS 376387-68-7 appears in our catalog under these names: 1-tert-Butyl-5-methyl-1h-pyrazole-3-carboxylic acid, 95%, 1–(tert–Butyl)–5–methyl–1H–pyrazole–3–carboxylic acid, 1-tert-Butyl-5-methyl-1H-pyrazole-3-carboxylic acid, 1-(tert-Butyl)-5-methyl-1H-pyrazole-3-carboxylic acid 95%, 1-(tert-Butyl)-5-methyl-1H-pyrazole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 2,5g, 2.5g.
1-tert-butyl-5-methylpyrazole-3-carboxylic acid (CAS 376387-68-7) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 1-tert-butyl-5-methylpyrazole-3-carboxylic acid. InChIKey: FCFGJNOOQYQMKY-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1-tert-butyl-5-methylpyrazole-3-carboxylic acid |
| InChIKey | FCFGJNOOQYQMKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)