CAS 90565-74-5 appears in our catalog under these names: 6,6-Dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione, 95%, 6,6-Dimethyl-1,3-diazaspiro(4.4)nonane-2,4-dione, 95%, 6,6-Dimethyl-1,3-diazaspiro(4.4)nonane-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
9,9-dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione (CAS 90565-74-5) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 9,9-dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione. InChIKey: NTIBUKKLSXENLG-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 9,9-dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione |
| InChIKey | NTIBUKKLSXENLG-UHFFFAOYSA-N |
| SMILES | CC1(CCCC12C(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)