CAS 89270-13-3 is the registry number for Methyl 5-isopropyl-3-methyl-1H-pyrazole-4-carboxylate, 96%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 10g, 25g, 5g, on request.
Methyl 5-methyl-3-propan-2-yl-1H-pyrazole-4-carboxylate (CAS 89270-13-3) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: methyl 5-methyl-3-propan-2-yl-1H-pyrazole-4-carboxylate. InChIKey: RGWSCPIZOATVLA-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | methyl 5-methyl-3-propan-2-yl-1H-pyrazole-4-carboxylate |
| InChIKey | RGWSCPIZOATVLA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C(C)C)C(=O)OC |
Computed by PubChem (NCBI)