CAS 956935-28-7 appears in our catalog under these names: (1-Ethyl-3,5-dimethyl-1h-pyrazol-4-yl)acetic acid, 95%, 2-(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
2-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetic acid (CAS 956935-28-7) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetic acid. InChIKey: UYGRRTZTDSPSJM-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetic acid |
| InChIKey | UYGRRTZTDSPSJM-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)CC(=O)O)C |
Computed by PubChem (NCBI)