CAS 175277-09-5 appears in our catalog under these names: 1-(tert-Butyl)-3-methyl-1h-pyrazole-5-carboxylic acid, 98%, 1–(tert–Butyl)–3–methyl–1H–pyrazole–5–carboxylic acid, 1-(tert-Butyl)-3-methyl-1H-pyrazole-5-carboxylic acid, 1-(tert-Butyl)-3-methyl-1H-pyrazole-5-carboxylic acid, 97% , 1-(tert-Butyl)-3-methyl-1H-pyrazole-5-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Thermo Scientific. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 10g, 50g, 100g.
2-tert-butyl-5-methylpyrazole-3-carboxylic acid (CAS 175277-09-5) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-tert-butyl-5-methylpyrazole-3-carboxylic acid. InChIKey: JZPMLZWJUMATOQ-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-tert-butyl-5-methylpyrazole-3-carboxylic acid |
| InChIKey | JZPMLZWJUMATOQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)