1,3-Dichloro-5-fluoro-2-nitrobenzene, 95%
cas: 180134-21-8 — see every product listed under this CAS number, including other names
1,3-Dichloro-5-fluoro-2-nitrobenzene, 95% (CAS 180134-21-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A712960-250mg |
| cas | 180134-21-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1338.25 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1697.20 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1926.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1,3-dichloro-5-fluoro-2-nitrobenzene (CAS 180134-21-8) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 1,3-dichloro-5-fluoro-2-nitrobenzene. InChIKey: JWOMHBXKHCIYHQ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 1,3-dichloro-5-fluoro-2-nitrobenzene |
| InChIKey | JWOMHBXKHCIYHQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)
