CAS 393-79-3 appears in our catalog under these names: 2,4–Dichloro–3–fluoronitrobenzene, 2,4-Dichloro-3-fluoronitrobenzene 98%, 2,4-Dichloro-3-fluoronitrobenzene, 95%, Benzene, 1,3-dichloro-2-fluoro-4-nitro-, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 500g, 1g, 100g, 100mg, 250mg, 10g.
1,3-dichloro-2-fluoro-4-nitrobenzene (CAS 393-79-3) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 1,3-dichloro-2-fluoro-4-nitrobenzene. InChIKey: JSEVUBOYVADSHX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 1,3-dichloro-2-fluoro-4-nitrobenzene |
| InChIKey | JSEVUBOYVADSHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)F)Cl |
Computed by PubChem (NCBI)