CAS 149468-00-8 appears in our catalog under these names: 2,6-Dichloro-3-fluoroisonicotinic acid, 95%, 2,6–Dichloro–3–fluoro–isonicotinic acid, 2,6-Dichloro-3-fluoropyridine-4-carboxylic acid, 2,6-Dichloro-3-fluoroisonicotinic acid 97%, 2,6-Dichloro-3-fluoro-4-pyridinecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 2,5g, 5g.
2,6-dichloro-3-fluoropyridine-4-carboxylic acid (CAS 149468-00-8) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 2,6-dichloro-3-fluoropyridine-4-carboxylic acid. InChIKey: LBFKRKJBMFOOBC-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 2,6-dichloro-3-fluoropyridine-4-carboxylic acid |
| InChIKey | LBFKRKJBMFOOBC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)