CAS 82671-06-5 appears in our catalog under these names: 2,6-Dichloro-5-fluoronicotinic acid, 97% , 2,6-Dichloro-5-fluoronicotinic acid 98%, 2,6-Dichloro-5-fluoronicotinic acid, 99.43%, 2,6-Dichloro-5-fluoronicotinic Acid, >97.0%(T), 2,6-Dichloro-5-fluoro-nicotinic acid, 96%. Offered by: Thermo Scientific, Ambeed, MedChemExpress, TCI, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 500g, 1000g, 25 g.
2,6-dichloro-5-fluoropyridine-3-carboxylic acid (CAS 82671-06-5) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 2,6-dichloro-5-fluoropyridine-3-carboxylic acid. InChIKey: LTDGKGCHRNNCAC-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 2,6-dichloro-5-fluoropyridine-3-carboxylic acid |
| InChIKey | LTDGKGCHRNNCAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)