CAS 36556-51-1 appears in our catalog under these names: 2,3-Dichloro-4-fluoronitrobenzene 98%, 2,3-Dichloro-4-fluoronitrobenzene, 98%, 98%, 2,3-Dichloro-4-fluoronitrobenzene, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
2,3-dichloro-1-fluoro-4-nitrobenzene (CAS 36556-51-1) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 2,3-dichloro-1-fluoro-4-nitrobenzene. InChIKey: QWQJCMSWGFVURH-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 2,3-dichloro-1-fluoro-4-nitrobenzene |
| InChIKey | QWQJCMSWGFVURH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)Cl)F |
Computed by PubChem (NCBI)