CAS 35754-37-1 is the registry number for 1,2-Dichloro-3-fluoro-5-nitrobenzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dichloro-3-fluoro-5-nitrobenzene (CAS 35754-37-1) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 1,2-dichloro-3-fluoro-5-nitrobenzene. InChIKey: QWUWGSGNPJOYQU-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 1,2-dichloro-3-fluoro-5-nitrobenzene |
| InChIKey | QWUWGSGNPJOYQU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)