cas: 21902-40-9 — see every product listed under this CAS number, including other names
1,3-Dichloro-5-methylisoquinoline 95% (CAS 21902-40-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A964167-250mg |
| cas | 21902-40-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 303.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A964167 |
1,3-dichloro-5-methylisoquinoline (CAS 21902-40-9) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 1,3-dichloro-5-methylisoquinoline. InChIKey: LDSLPCOBAYAVEI-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 1,3-dichloro-5-methylisoquinoline |
| InChIKey | LDSLPCOBAYAVEI-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(N=C(C2=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)