CAS 20151-11-5 appears in our catalog under these names: 2-Chloro-4-(chloromethyl)quinoline, 95%, 2–Chloro–4–(chloromethyl)quinoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-4-(chloromethyl)quinoline (CAS 20151-11-5) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2-chloro-4-(chloromethyl)quinoline. InChIKey: REPYMUWBGDQIOL-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2-chloro-4-(chloromethyl)quinoline |
| InChIKey | REPYMUWBGDQIOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)Cl)CCl |
Computed by PubChem (NCBI)