CAS 132118-32-2 appears in our catalog under these names: 2,6-Dichloro-3-methylquinoline, 95%, 2,6–Dichloro–3–methylquinoline, 2,6-Dichloro-3-methylquinoline, 97%, 97%, 2,6-Dichloro-3-methylquinoline. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 50mg.
2,6-dichloro-3-methylquinoline (CAS 132118-32-2) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,6-dichloro-3-methylquinoline. InChIKey: NGCCQISMNZBKJJ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,6-dichloro-3-methylquinoline |
| InChIKey | NGCCQISMNZBKJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Cl)N=C1Cl |
Computed by PubChem (NCBI)