CAS 56857-97-7 appears in our catalog under these names: 2,4-Dichloro-3-methylquinoline, 98%, 2,4-Dichloro-3-methylquinoline, 95+%, 2,4-dichloro-3-methylquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g, 100mg.
2,4-dichloro-3-methylquinoline (CAS 56857-97-7) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,4-dichloro-3-methylquinoline. InChIKey: NVZMNNRRENJIRV-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,4-dichloro-3-methylquinoline |
| InChIKey | NVZMNNRRENJIRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N=C1Cl)Cl |
Computed by PubChem (NCBI)