CAS 102878-18-2 appears in our catalog under these names: 2,4-Dichloro-6-methylquinoline, 98%, 2,4-Dichloro-6-methylquinoline, 97%, 2,4-Dichloro-6-methylquinoline, 98%, 98%, 2,4-Dichloro-6-methylquinoline. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
2,4-dichloro-6-methylquinoline (CAS 102878-18-2) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,4-dichloro-6-methylquinoline. InChIKey: GLYIJJUSFYXLNF-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,4-dichloro-6-methylquinoline |
| InChIKey | GLYIJJUSFYXLNF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)