cas: 21902-37-4 — see every product listed under this CAS number, including other names
1,3-Dichloro-7-methylisoquinoline, 97% (CAS 21902-37-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210792-250MG |
| cas | 21902-37-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 2132.60 Pln | |
| Fluorochem | 10g | 3626.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,3-dichloro-7-methylisoquinoline (CAS 21902-37-4) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 1,3-dichloro-7-methylisoquinoline. InChIKey: BPEFMJHEHCHWPC-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 1,3-dichloro-7-methylisoquinoline |
| InChIKey | BPEFMJHEHCHWPC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C(C=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)