cas: 153338-23-9 — see every product listed under this CAS number, including other names
1,3-Difluoro-2-(trifluoromethoxy)benzene 98% (CAS 153338-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A623601-250mg |
| cas | 153338-23-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 1410.56 Pln | |
| Ambeed | 100g | 4364.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A623601 |
1,3-difluoro-2-(trifluoromethoxy)benzene (CAS 153338-23-9) is a chemical compound with the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. IUPAC name: 1,3-difluoro-2-(trifluoromethoxy)benzene. InChIKey: CETQITNIBDFSTM-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 1,3-difluoro-2-(trifluoromethoxy)benzene |
| InChIKey | CETQITNIBDFSTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)(F)F)F |
Computed by PubChem (NCBI)