1,3-Dimethoxynaphthalene, 95%
cas: 10075-61-3 — see every product listed under this CAS number, including other names
1,3-Dimethoxynaphthalene, 95% (CAS 10075-61-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A434930-100mg |
| cas | 10075-61-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 998.94 Pln | |
| Ambeed | 5g | 2867.94 Pln | |
| Ambeed | 10g | 4553.38 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 2882.00 Pln | |
| Chemat | 10g | 4576.40 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 475.41 Pln | |
| BLDpharm | 1g | 1075.20 Pln | |
| BLDpharm | 5g | 3085.60 Pln | |
| BLDpharm | 10g | 4901.63 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,3-dimethoxynaphthalene (CAS 10075-61-3) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 1,3-dimethoxynaphthalene. InChIKey: XAVOEDQPSYWNHI-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 1,3-dimethoxynaphthalene |
| InChIKey | XAVOEDQPSYWNHI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C(=C1)OC |
Computed by PubChem (NCBI)