1,3-Dioxoisoindolin-2-yl 2-ethylbutanoate, 97%
cas: 2245137-17-9 — see every product listed under this CAS number, including other names
1,3-Dioxoisoindolin-2-yl 2-ethylbutanoate, 97% (CAS 2245137-17-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1496198-250mg |
| cas | 2245137-17-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1215.88 Pln | |
| Ambeed | 10g | 1911.19 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 1191.83 Pln | |
| BLDpharm | 10g | 1874.92 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 899.60 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1669.22 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1,3-dioxoisoindol-2-yl) 2-ethylbutanoate (CAS 2245137-17-9) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-ethylbutanoate. InChIKey: AZFZLIVEASQLQW-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-ethylbutanoate |
| InChIKey | AZFZLIVEASQLQW-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)