CAS 848444-79-1 appears in our catalog under these names: 1-Boc-4-carboxyindole, 98%, 1-Boc-4-Carboxyindole, 98%, 98%, 1-(tert-Butoxycarbonyl)-1H-indole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Fluorochem, Chemat, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid (CAS 848444-79-1) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid. InChIKey: HQSFITLRCKIRLE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid |
| InChIKey | HQSFITLRCKIRLE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C(C=CC=C21)C(=O)O |
Computed by PubChem (NCBI)