CAS 315693-84-6 is the registry number for Methyl 4-[(dimethyl-1,2-oxazol-4-yl)methoxy]benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate (CAS 315693-84-6) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate. InChIKey: UFJRNXGJFJJDFO-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
| InChIKey | UFJRNXGJFJJDFO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)