Products 124729-87-9
CAS 124729-87-9 is the registry number for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (CAS 124729-87-9) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate. InChIKey: FMGSSBUHMCWNDB-NSHDSACASA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| InChIKey | FMGSSBUHMCWNDB-NSHDSACASA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)